C20H19ClFNO4 — CID 157151703
(E)-but-2-enedioic acid;1-[2-(4-chloro-2-fluorophenyl)phenyl]but-3-en-1-amine (PubChem CID 157151703) has the molecular formula C20H19ClFNO4 and a molecular weight of 391.83 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(4-chloro-2-fluorophenyl)phenyl]but-3-en-1-amine.
| Compound Name | (E)-but-2-enedioic acid;1-[2-(4-chloro-2-fluorophenyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 157151703 |
| Molecular Formula | C20H19ClFNO4 |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(4-chloro-2-fluorophenyl)phenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1ccccc1-c1ccc(Cl)cc1F.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H15ClFN.C4H4O4/c1-2-5-16(19)14-7-4-3-6-12(14)13-9-8-11(17)10-15(13)18;5-3(6)1-2-4(7)8/h2-4,6-10,16H,1,5,19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ALIDQIHIUIBVAN-WLHGVMLRSA-N |
| XLogP | 4.43 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|