C20H20FNO4 — CID 159321301
(E)-but-2-enedioic acid;1-[2-(4-fluorophenyl)phenyl]but-3-en-1-amine (PubChem CID 159321301) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(4-fluorophenyl)phenyl]but-3-en-1-amine.
| Compound Name | (E)-but-2-enedioic acid;1-[2-(4-fluorophenyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 159321301 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(4-fluorophenyl)phenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1ccccc1-c1ccc(F)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H16FN.C4H4O4/c1-2-5-16(18)15-7-4-3-6-14(15)12-8-10-13(17)11-9-12;5-3(6)1-2-4(7)8/h2-4,6-11,16H,1,5,18H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | LDUKNRQAXXEVRW-WLHGVMLRSA-N |
| XLogP | 3.78 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|