C35H41F2N3O6 — CID 174204501
2-[[3-(4,4-difluorocyclohexyl)-2-[(4Z,7S)-7-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-8-oxo-2,3,6,7-tetrahydroazocin-1-yl]propanoyl]-methylamino]acetic acid (PubChem CID 174204501) has the molecular formula C35H41F2N3O6 and a molecular weight of 637.72 g/mol. Its IUPAC name is 2-[[3-(4,4-difluorocyclohexyl)-2-[(4Z,7S)-7-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-8-oxo-2,3,6,7-tetrahydroazocin-1-yl]propanoyl]-methylamino]acetic acid.
| Compound Name | 2-[[3-(4,4-difluorocyclohexyl)-2-[(4Z,7S)-7-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-8-oxo-2,3,6,7-tetrahydroazocin-1-yl]propanoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 174204501 |
| Molecular Formula | C35H41F2N3O6 |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | 2-[[3-(4,4-difluorocyclohexyl)-2-[(4Z,7S)-7-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-8-oxo-2,3,6,7-tetrahydroazocin-1-yl]propanoyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C(CC1CCC(F)(F)CC1)N1CC/C=C\C[C@H](N(C)C(=O)OCC2c3ccccc3-c3ccccc32)C1=O |
| InChI | InChI=1S/C35H41F2N3O6/c1-38(21-31(41)42)32(43)30(20-23-15-17-35(36,37)18-16-23)40-19-9-3-4-14-29(33(40)44)39(2)34(45)46-22-28-26-12-7-5-10-24(26)25-11-6-8-13-27(25)28/h3-8,10-13,23,28-30H,9,14-22H2,1-2H3,(H,41,42)/b4-3-/t29-,30?/m0/s1 |
| InChIKey | FTIIIQPDYICYIV-RRFQFTGBSA-N |
| XLogP | 5.54 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|