C35H36BN3O6 — CID 174022217
CID 174022217 (PubChem CID 174022217) has the molecular formula C35H36BN3O6 and a molecular weight of 605.50 g/mol.
| Compound Name | CID 174022217 |
|---|---|
| PubChem CID | 174022217 |
| Molecular Formula | C35H36BN3O6 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C[C@@H](C(=O)N(C)CC(=O)O)N2CC/C=C\C[C@H](N(C)C(=O)OCC3c4ccccc4-c4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C35H36BN3O6/c1-37(21-32(40)41)33(42)31(20-23-15-17-24(36)18-16-23)39-19-9-3-4-14-30(34(39)43)38(2)35(44)45-22-29-27-12-7-5-10-25(27)26-11-6-8-13-28(26)29/h3-8,10-13,15-18,29-31H,9,14,19-22H2,1-2H3,(H,40,41)/b4-3-/t30-,31-/m0/s1 |
| InChIKey | PRDBQFUBQRMYDJ-QMLGYSKRSA-N |
| XLogP | 3.36 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|