About benzenesulfonamido 1H-pyrazole-5-carboxylate
benzenesulfonamido 1H-pyrazole-5-carboxylate (PubChem CID 174204990) has the molecular formula C10H9N3O4S
and a molecular weight of 267.27 g/mol. Its IUPAC name is benzenesulfonamido 1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | benzenesulfonamido 1H-pyrazole-5-carboxylate |
| PubChem CID | 174204990 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | benzenesulfonamido 1H-pyrazole-5-carboxylate |
| SMILES | O=C(ONS(=O)(=O)c1ccccc1)c1ccn[nH]1 |
| InChI | InChI=1S/C10H9N3O4S/c14-10(9-6-7-11-12-9)17-13-18(15,16)8-4-2-1-3-5-8/h1-7,13H,(H,11,12) |
| InChIKey | RCFZODPPWOLQBD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonamido 1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonamido 1H-pyrazole-5-carboxylate?
The IUPAC name of benzenesulfonamido 1H-pyrazole-5-carboxylate (CID 174204990) is benzenesulfonamido 1H-pyrazole-5-carboxylate.
What is the SMILES notation for benzenesulfonamido 1H-pyrazole-5-carboxylate?
The canonical SMILES for benzenesulfonamido 1H-pyrazole-5-carboxylate is O=C(ONS(=O)(=O)c1ccccc1)c1ccn[nH]1.
What is the InChIKey of benzenesulfonamido 1H-pyrazole-5-carboxylate?
The InChIKey is RCFZODPPWOLQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4S/c14-10(9-6-7-11-12-9)17-13-18(15,16)8-4-2-1-3-5-8/h1-7,13H,(H,11,12).
What are the key properties of benzenesulfonamido 1H-pyrazole-5-carboxylate?
benzenesulfonamido 1H-pyrazole-5-carboxylate has a molecular weight of 267.27 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonamido 1H-pyrazole-5-carboxylate is sourced from PubChem (CID 174204990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).