About lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride
lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride (PubChem CID 174205093) has the molecular formula C10H14LiNO5S
and a molecular weight of 267.23 g/mol. Its IUPAC name is lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride.
Molecular Properties
| Compound Name | lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride |
| PubChem CID | 174205093 |
| Molecular Formula | C10H14LiNO5S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride |
| SMILES | CCOC(=O)c1cc(C)ccc1OS(N)(=O)=O.[H-].[Li+] |
| InChI | InChI=1S/C10H13NO5S.Li.H/c1-3-15-10(12)8-6-7(2)4-5-9(8)16-17(11,13)14;;/h4-6H,3H2,1-2H3,(H2,11,13,14);;/q;+1;-1 |
| InChIKey | OOORTTJLGAKPSO-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride?
The IUPAC name of lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride (CID 174205093) is lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride.
What is the SMILES notation for lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride?
The canonical SMILES for lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride is CCOC(=O)c1cc(C)ccc1OS(N)(=O)=O.[H-].[Li+].
What is the InChIKey of lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride?
The InChIKey is OOORTTJLGAKPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5S.Li.H/c1-3-15-10(12)8-6-7(2)4-5-9(8)16-17(11,13)14;;/h4-6H,3H2,1-2H3,(H2,11,13,14);;/q;+1;-1.
What are the key properties of lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride?
lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride has a molecular weight of 267.23 g/mol, XLogP of -2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethyl 5-methyl-2-sulfamoyloxybenzoate;hydride is sourced from PubChem (CID 174205093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).