C20H18FN3O3 — CID 17420576
4-cyano-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 17420576) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-cyano-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | 4-cyano-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 17420576 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-cyano-N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C20H18FN3O3/c1-14-18(15(13-22)20(27-14)24-9-5-6-10-24)19(25)23(2)11-12-26-17-8-4-3-7-16(17)21/h3-10H,11-12H2,1-2H3 |
| InChIKey | RXUUBURFZXFGFK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|