C20H18N2O4 — CID 8782766
(2-ethoxyphenyl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782766) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | (2-ethoxyphenyl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8782766 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2-ethoxyphenyl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | CCOc1ccccc1COC(=O)c1c(C)oc(-n2cccc2)c1C#N |
| InChI | InChI=1S/C20H18N2O4/c1-3-24-17-9-5-4-8-15(17)13-25-20(23)18-14(2)26-19(16(18)12-21)22-10-6-7-11-22/h4-11H,3,13H2,1-2H3 |
| InChIKey | ARJOUQAITQDFBO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|