C21H15N3O4 — CID 8782742
(5-phenyl-1,3-oxazol-2-yl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782742) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8782742 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H15N3O4/c1-14-19(16(11-22)20(27-14)24-9-5-6-10-24)21(25)26-13-18-23-12-17(28-18)15-7-3-2-4-8-15/h2-10,12H,13H2,1H3 |
| InChIKey | MLNBRNMELVFGDH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|