C33H42ClN3O4S — CID 174207122
(4S)-7-chloro-N-(3-methylhex-5-en-2-ylsulfonyl)-5'-[[(2S)-1-prop-2-enylazetidin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide (PubChem CID 174207122) has the molecular formula C33H42ClN3O4S and a molecular weight of 612.24 g/mol. Its IUPAC name is (4S)-7-chloro-N-(3-methylhex-5-en-2-ylsulfonyl)-5'-[[(2S)-1-prop-2-enylazetidin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide.
| Compound Name | (4S)-7-chloro-N-(3-methylhex-5-en-2-ylsulfonyl)-5'-[[(2S)-1-prop-2-enylazetidin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
|---|---|
| PubChem CID | 174207122 |
| Molecular Formula | C33H42ClN3O4S |
| Molecular Weight | 612.24 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (4S)-7-chloro-N-(3-methylhex-5-en-2-ylsulfonyl)-5'-[[(2S)-1-prop-2-enylazetidin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
| SMILES | C=CCC(C)C(C)S(=O)(=O)NC(=O)c1ccc2c(c1)N(C[C@@H]1CCN1CC=C)C[C@@]1(CCCc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C33H42ClN3O4S/c1-5-8-23(3)24(4)42(39,40)35-32(38)26-10-13-31-30(19-26)37(20-28-14-17-36(28)16-6-2)21-33(22-41-31)15-7-9-25-18-27(34)11-12-29(25)33/h5-6,10-13,18-19,23-24,28H,1-2,7-9,14-17,20-22H2,3-4H3,(H,35,38)/t23?,24?,28-,33-/m0/s1 |
| InChIKey | KCEVRVWRRXJNDQ-NGPMPJLTSA-N |
| XLogP | 5.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|