C18H18ClNO — CID 174209684
5-chloro-1-[(3,4-dimethylphenyl)methyl]-3-methyl-3H-indol-2-one (PubChem CID 174209684) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-chloro-1-[(3,4-dimethylphenyl)methyl]-3-methyl-3H-indol-2-one.
| Compound Name | 5-chloro-1-[(3,4-dimethylphenyl)methyl]-3-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 174209684 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-chloro-1-[(3,4-dimethylphenyl)methyl]-3-methyl-3H-indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)C(C)c3cc(Cl)ccc32)cc1C |
| InChI | InChI=1S/C18H18ClNO/c1-11-4-5-14(8-12(11)2)10-20-17-7-6-15(19)9-16(17)13(3)18(20)21/h4-9,13H,10H2,1-3H3 |
| InChIKey | AUPZQINYEVSDIJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |