C24H36N2O2 — CID 174212146
1-tert-butyl-2-[4-(cyclopentylamino)phenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxylic acid (PubChem CID 174212146) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-tert-butyl-2-[4-(cyclopentylamino)phenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxylic acid.
| Compound Name | 1-tert-butyl-2-[4-(cyclopentylamino)phenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174212146 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-tert-butyl-2-[4-(cyclopentylamino)phenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)N1C2CCCC2CC(C(=O)O)C1c1ccc(NC2CCCC2)cc1 |
| InChI | InChI=1S/C24H36N2O2/c1-24(2,3)26-21-10-6-7-17(21)15-20(23(27)28)22(26)16-11-13-19(14-12-16)25-18-8-4-5-9-18/h11-14,17-18,20-22,25H,4-10,15H2,1-3H3,(H,27,28) |
| InChIKey | XBETVNAJHCLUBB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |