C31H60N2 — CID 159306478
(2S,3aS,6aS)-1,2-ditert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole;(2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 159306478) has the molecular formula C31H60N2 and a molecular weight of 460.84 g/mol. Its IUPAC name is (2S,3aS,6aS)-1,2-ditert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole;(2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (2S,3aS,6aS)-1,2-ditert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole;(2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 159306478 |
| Molecular Formula | C31H60N2 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.48 |
| IUPAC Name | (2S,3aS,6aS)-1,2-ditert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole;(2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CC(C)(C)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(C)(C)C.CC(C)(C)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(C)(C)C |
| InChI | InChI=1S/C16H31N.C15H29N/c1-15(2,3)14-11-12-9-7-8-10-13(12)17(14)16(4,5)6;1-14(2,3)13-10-11-8-7-9-12(11)16(13)15(4,5)6/h12-14H,7-11H2,1-6H3;11-13H,7-10H2,1-6H3/t12-,13-,14-;11-,12-,13-/m00/s1 |
| InChIKey | LBZCJOIQMFPZLF-ZBCLICGJSA-N |
| XLogP | 8.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |