C16H31N — CID 59701515
(2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 59701515) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 59701515 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (2S,3aS,7aS)-1,2-ditert-butyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CC(C)(C)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(C)(C)C |
| InChI | InChI=1S/C16H31N/c1-15(2,3)14-11-12-9-7-8-10-13(12)17(14)16(4,5)6/h12-14H,7-11H2,1-6H3/t12-,13-,14-/m0/s1 |
| InChIKey | FDCBATHZZQVHGY-IHRRRGAJSA-N |
| XLogP | 4.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |