C15H31N — CID 164846076
(2S,6S)-1,4-ditert-butyl-2,6-dimethylpiperidine (PubChem CID 164846076) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is (2S,6S)-1,4-ditert-butyl-2,6-dimethylpiperidine.
| Compound Name | (2S,6S)-1,4-ditert-butyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 164846076 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (2S,6S)-1,4-ditert-butyl-2,6-dimethylpiperidine |
| SMILES | C[C@H]1CC(C(C)(C)C)C[C@H](C)N1C(C)(C)C |
| InChI | InChI=1S/C15H31N/c1-11-9-13(14(3,4)5)10-12(2)16(11)15(6,7)8/h11-13H,9-10H2,1-8H3/t11-,12-/m0/s1 |
| InChIKey | IEJGHPBWAIWMRA-RYUDHWBXSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |