About 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane
3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane (PubChem CID 138627504) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane |
| PubChem CID | 138627504 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane |
| SMILES | CC1C2CC(C(C)N1C(C)(C)C)C2C(C)(C)C |
| InChI | InChI=1S/C16H31N/c1-10-12-9-13(14(12)15(3,4)5)11(2)17(10)16(6,7)8/h10-14H,9H2,1-8H3 |
| InChIKey | MFECAJMOJQKYFW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane?
The IUPAC name of 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane (CID 138627504) is 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane.
What is the SMILES notation for 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane?
The canonical SMILES for 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane is CC1C2CC(C(C)N1C(C)(C)C)C2C(C)(C)C.
What is the InChIKey of 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane?
The InChIKey is MFECAJMOJQKYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N/c1-10-12-9-13(14(12)15(3,4)5)11(2)17(10)16(6,7)8/h10-14H,9H2,1-8H3.
What are the key properties of 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane?
3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane has a molecular weight of 237.43 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-ditert-butyl-2,4-dimethyl-3-azabicyclo[3.1.1]heptane is sourced from PubChem (CID 138627504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).