C18H35N — CID 59918176
6,7-ditert-butyl-8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 59918176) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 6,7-ditert-butyl-8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | 6,7-ditert-butyl-8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 59918176 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 6,7-ditert-butyl-8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC1C2CNCCC2CC(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C18H35N/c1-12-14-11-19-9-8-13(14)10-15(17(2,3)4)16(12)18(5,6)7/h12-16,19H,8-11H2,1-7H3 |
| InChIKey | MSSJZTGHALTECL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |