C20H18BrN3O4 — CID 174214658
6-[(2S)-2-bromo-2-(2-hydroxyethoxy)ethyl]-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol (PubChem CID 174214658) has the molecular formula C20H18BrN3O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is 6-[(2S)-2-bromo-2-(2-hydroxyethoxy)ethyl]-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol.
| Compound Name | 6-[(2S)-2-bromo-2-(2-hydroxyethoxy)ethyl]-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 174214658 |
| Molecular Formula | C20H18BrN3O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 6-[(2S)-2-bromo-2-(2-hydroxyethoxy)ethyl]-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol |
| SMILES | O=Nc1c(-c2c(O)[nH]c3cc(C[C@H](Br)OCCO)ccc23)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H18BrN3O4/c21-16(28-8-7-25)10-11-5-6-12-15(9-11)23-20(26)17(12)19-18(24-27)13-3-1-2-4-14(13)22-19/h1-6,9,16,22-23,25-26H,7-8,10H2/t16-/m1/s1 |
| InChIKey | DVPSNMAQZUYKJA-MRXNPFEDSA-N |
| XLogP | 4.69 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|