C20H33ClN2O8 — CID 174215195
ethyl 2-chloro-2-oxoacetate;ethyl 2-[cyclobutyl-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]amino]-2-oxoacetate (PubChem CID 174215195) has the molecular formula C20H33ClN2O8 and a molecular weight of 464.94 g/mol. Its IUPAC name is ethyl 2-chloro-2-oxoacetate;ethyl 2-[cyclobutyl-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-[cyclobutyl-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 174215195 |
| Molecular Formula | C20H33ClN2O8 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-[cyclobutyl-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Cl.CCOC(=O)C(=O)N(C(C)CNC(=O)OC(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C16H28N2O5.C4H5ClO3/c1-6-22-14(20)13(19)18(12-8-7-9-12)11(2)10-17-15(21)23-16(3,4)5;1-2-8-4(7)3(5)6/h11-12H,6-10H2,1-5H3,(H,17,21);2H2,1H3 |
| InChIKey | ZLFTVJXCZHBASP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|