C8H14N2O6 — CID 174215532
(2S)-2-[methoxy(methyl)amino]oxycarbonylmorpholine-4-carboxylic acid (PubChem CID 174215532) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is (2S)-2-[methoxy(methyl)amino]oxycarbonylmorpholine-4-carboxylic acid.
| Compound Name | (2S)-2-[methoxy(methyl)amino]oxycarbonylmorpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174215532 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (2S)-2-[methoxy(methyl)amino]oxycarbonylmorpholine-4-carboxylic acid |
| SMILES | CON(C)OC(=O)[C@@H]1CN(C(=O)O)CCO1 |
| InChI | InChI=1S/C8H14N2O6/c1-9(14-2)16-7(11)6-5-10(8(12)13)3-4-15-6/h6H,3-5H2,1-2H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | ZAXCZDGHRPIOOH-LURJTMIESA-N |
| XLogP | -0.68 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|