C10H16F3N3O5S2 — CID 174217823
1-methyl-3-(2-methylpyrrolidin-1-yl)sulfonylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 174217823) has the molecular formula C10H16F3N3O5S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpyrrolidin-1-yl)sulfonylimidazol-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-methyl-3-(2-methylpyrrolidin-1-yl)sulfonylimidazol-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174217823 |
| Molecular Formula | C10H16F3N3O5S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-methyl-3-(2-methylpyrrolidin-1-yl)sulfonylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | CC1CCCN1S(=O)(=O)n1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H16N3O2S.CHF3O3S/c1-9-4-3-5-12(9)15(13,14)11-7-6-10(2)8-11;2-1(3,4)8(5,6)7/h6-9H,3-5H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KBINLGPVSZYNTR-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|