C12H13F4NO2 — CID 174217865
5-fluoro-2-hydroxy-N-propan-2-yl-N-(1,2,2-trifluoroethyl)benzamide (PubChem CID 174217865) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-propan-2-yl-N-(1,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-propan-2-yl-N-(1,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 174217865 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-propan-2-yl-N-(1,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)N(C(=O)c1cc(F)ccc1O)C(F)C(F)F |
| InChI | InChI=1S/C12H13F4NO2/c1-6(2)17(11(16)10(14)15)12(19)8-5-7(13)3-4-9(8)18/h3-6,10-11,18H,1-2H3 |
| InChIKey | IJDLPBFJFAGVAM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|