C20H23F6N7O2 — CID 174218156
5-(trifluoromethyl)-4-[[(1E)-1-[2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]ethoxyimino]propan-2-yl]amino]-1H-pyridazin-6-one (PubChem CID 174218156) has the molecular formula C20H23F6N7O2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 5-(trifluoromethyl)-4-[[(1E)-1-[2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]ethoxyimino]propan-2-yl]amino]-1H-pyridazin-6-one.
| Compound Name | 5-(trifluoromethyl)-4-[[(1E)-1-[2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]ethoxyimino]propan-2-yl]amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 174218156 |
| Molecular Formula | C20H23F6N7O2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 5-(trifluoromethyl)-4-[[(1E)-1-[2-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]ethoxyimino]propan-2-yl]amino]-1H-pyridazin-6-one |
| SMILES | CC(/C=N/OCCC1CCN(c2ncc(C(F)(F)F)cn2)CC1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H23F6N7O2/c1-12(31-15-11-29-32-17(34)16(15)20(24,25)26)8-30-35-7-4-13-2-5-33(6-3-13)18-27-9-14(10-28-18)19(21,22)23/h8-13H,2-7H2,1H3,(H2,31,32,34)/b30-8+ |
| InChIKey | UCCIEXDMBDCHNY-BEJOPBHTSA-N |
| XLogP | 3.71 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|