C19H29N5O4 — CID 174219760
[1-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]piperidin-4-yl]methylcarbamic acid (PubChem CID 174219760) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is [1-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]piperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]piperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 174219760 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | [1-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]piperidin-4-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCN(CCN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)CC1 |
| InChI | InChI=1S/C19H29N5O4/c25-19(26)20-15-16-5-7-21(8-6-16)9-10-22-11-13-23(14-12-22)17-1-3-18(4-2-17)24(27)28/h1-4,16,20H,5-15H2,(H,25,26) |
| InChIKey | UAUHAKQUWRZSHW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|