C22H28N4O3 — CID 174220120
[(2R)-3-[4-(benzylamino)phenyl]-1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamic acid (PubChem CID 174220120) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2R)-3-[4-(benzylamino)phenyl]-1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2R)-3-[4-(benzylamino)phenyl]-1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174220120 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [(2R)-3-[4-(benzylamino)phenyl]-1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamic acid |
| SMILES | CN1CCN(C(=O)[C@@H](Cc2ccc(NCc3ccccc3)cc2)NC(=O)O)CC1 |
| InChI | InChI=1S/C22H28N4O3/c1-25-11-13-26(14-12-25)21(27)20(24-22(28)29)15-17-7-9-19(10-8-17)23-16-18-5-3-2-4-6-18/h2-10,20,23-24H,11-16H2,1H3,(H,28,29)/t20-/m1/s1 |
| InChIKey | PGGQOHYRXRKLHZ-HXUWFJFHSA-N |
| XLogP | 2.25 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |