C6H6F3N2NaO3S — CID 174221328
sodium;hydride;[4-(trifluoromethyl)-2-pyridinyl]sulfamic acid (PubChem CID 174221328) has the molecular formula C6H6F3N2NaO3S and a molecular weight of 266.18 g/mol. Its IUPAC name is sodium;hydride;[4-(trifluoromethyl)-2-pyridinyl]sulfamic acid.
| Compound Name | sodium;hydride;[4-(trifluoromethyl)-2-pyridinyl]sulfamic acid |
|---|---|
| PubChem CID | 174221328 |
| Molecular Formula | C6H6F3N2NaO3S |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | sodium;hydride;[4-(trifluoromethyl)-2-pyridinyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1cc(C(F)(F)F)ccn1.[H-].[Na+] |
| InChI | InChI=1S/C6H5F3N2O3S.Na.H/c7-6(8,9)4-1-2-10-5(3-4)11-15(12,13)14;;/h1-3H,(H,10,11)(H,12,13,14);;/q;+1;-1 |
| InChIKey | DXHMSRJKXBOUCS-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|