C10H13N2NaO4S — CID 174221479
sodium N-(2-morpholin-4-ylphenyl)sulfamate (PubChem CID 174221479) has the molecular formula C10H13N2NaO4S and a molecular weight of 280.28 g/mol. Its IUPAC name is sodium N-(2-morpholin-4-ylphenyl)sulfamate.
| Compound Name | sodium N-(2-morpholin-4-ylphenyl)sulfamate |
|---|---|
| PubChem CID | 174221479 |
| Molecular Formula | C10H13N2NaO4S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | sodium N-(2-morpholin-4-ylphenyl)sulfamate |
| SMILES | O=S(=O)([O-])Nc1ccccc1N1CCOCC1.[Na+] |
| InChI | InChI=1S/C10H14N2O4S.Na/c13-17(14,15)11-9-3-1-2-4-10(9)12-5-7-16-8-6-12;/h1-4,11H,5-8H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | TUOGNCGVCDJTDU-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|