C7H11N2NaO4S — CID 174221570
sodium N-(5-tert-butyl-1,2-oxazol-3-yl)sulfamate (PubChem CID 174221570) has the molecular formula C7H11N2NaO4S and a molecular weight of 242.23 g/mol. Its IUPAC name is sodium N-(5-tert-butyl-1,2-oxazol-3-yl)sulfamate.
| Compound Name | sodium N-(5-tert-butyl-1,2-oxazol-3-yl)sulfamate |
|---|---|
| PubChem CID | 174221570 |
| Molecular Formula | C7H11N2NaO4S |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | sodium N-(5-tert-butyl-1,2-oxazol-3-yl)sulfamate |
| SMILES | CC(C)(C)c1cc(NS(=O)(=O)[O-])no1.[Na+] |
| InChI | InChI=1S/C7H12N2O4S.Na/c1-7(2,3)5-4-6(8-13-5)9-14(10,11)12;/h4H,1-3H3,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | WCJKBDLZGGPINS-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|