C12H21BrN2O2 — CID 143651754
2-bromo-2-methylpropane;N-(5-tert-butyl-1,2-oxazol-3-yl)formamide (PubChem CID 143651754) has the molecular formula C12H21BrN2O2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-bromo-2-methylpropane;N-(5-tert-butyl-1,2-oxazol-3-yl)formamide.
| Compound Name | 2-bromo-2-methylpropane;N-(5-tert-butyl-1,2-oxazol-3-yl)formamide |
|---|---|
| PubChem CID | 143651754 |
| Molecular Formula | C12H21BrN2O2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-bromo-2-methylpropane;N-(5-tert-butyl-1,2-oxazol-3-yl)formamide |
| SMILES | CC(C)(C)Br.CC(C)(C)c1cc(NC=O)no1 |
| InChI | InChI=1S/C8H12N2O2.C4H9Br/c1-8(2,3)6-4-7(9-5-11)10-12-6;1-4(2,3)5/h4-5H,1-3H3,(H,9,10,11);1-3H3 |
| InChIKey | GHMCWOKWVZTRCC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|