C15H15ClN8O — CID 174221869
1-(6-chloro-4-methyl-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 174221869) has the molecular formula C15H15ClN8O and a molecular weight of 358.79 g/mol. Its IUPAC name is 1-(6-chloro-4-methyl-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-(6-chloro-4-methyl-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 174221869 |
| Molecular Formula | C15H15ClN8O |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(6-chloro-4-methyl-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | Cc1cc(Cl)ncc1NC(=O)NC(C)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C15H15ClN8O/c1-9-6-12(16)19-7-11(9)23-15(25)22-10(2)13-20-8-21-24(13)14-17-4-3-5-18-14/h3-8,10H,1-2H3,(H2,22,23,25) |
| InChIKey | WBDMSPLBEZVZJC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|