C14H12ClIN8O — CID 174221954
1-(6-chloro-4-iodo-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 174221954) has the molecular formula C14H12ClIN8O and a molecular weight of 470.66 g/mol. Its IUPAC name is 1-(6-chloro-4-iodo-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-(6-chloro-4-iodo-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 174221954 |
| Molecular Formula | C14H12ClIN8O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 1-(6-chloro-4-iodo-3-pyridinyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1cnc(Cl)cc1I)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C14H12ClIN8O/c1-8(12-20-7-21-24(12)13-17-3-2-4-18-13)22-14(25)23-10-6-19-11(15)5-9(10)16/h2-8H,1H3,(H2,22,23,25) |
| InChIKey | FEOGOGOVTQFKDP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|