C16H13F3IN7O — CID 174221857
1-[2-iodo-4-(trifluoromethyl)phenyl]-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 174221857) has the molecular formula C16H13F3IN7O and a molecular weight of 503.23 g/mol. Its IUPAC name is 1-[2-iodo-4-(trifluoromethyl)phenyl]-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-[2-iodo-4-(trifluoromethyl)phenyl]-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 174221857 |
| Molecular Formula | C16H13F3IN7O |
| Molecular Weight | 503.23 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 1-[2-iodo-4-(trifluoromethyl)phenyl]-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(C(F)(F)F)cc1I)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C16H13F3IN7O/c1-9(13-23-8-24-27(13)14-21-5-2-6-22-14)25-15(28)26-12-4-3-10(7-11(12)20)16(17,18)19/h2-9H,1H3,(H2,25,26,28) |
| InChIKey | SNNHQASNKDRNQR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|