C16H15ClIN7O2 — CID 171409487
1-(4-chloro-2-iodo-5-methoxyphenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 171409487) has the molecular formula C16H15ClIN7O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is 1-(4-chloro-2-iodo-5-methoxyphenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-(4-chloro-2-iodo-5-methoxyphenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 171409487 |
| Molecular Formula | C16H15ClIN7O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 1-(4-chloro-2-iodo-5-methoxyphenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | COc1cc(NC(=O)N[C@@H](C)c2ncnn2-c2ncccn2)c(I)cc1Cl |
| InChI | InChI=1S/C16H15ClIN7O2/c1-9(14-21-8-22-25(14)15-19-4-3-5-20-15)23-16(26)24-12-7-13(27-2)10(17)6-11(12)18/h3-9H,1-2H3,(H2,23,24,26)/t9-/m0/s1 |
| InChIKey | CZAPXOAOMDPSLT-VIFPVBQESA-N |
| XLogP | 3.21 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|