C30H46NO4P — CID 174224512
2-[3-[[1-[2-(4,4-dimethylpentyl)-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]propyl-methylphosphinic acid (PubChem CID 174224512) has the molecular formula C30H46NO4P and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[3-[[1-[2-(4,4-dimethylpentyl)-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]propyl-methylphosphinic acid.
| Compound Name | 2-[3-[[1-[2-(4,4-dimethylpentyl)-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]propyl-methylphosphinic acid |
|---|---|
| PubChem CID | 174224512 |
| Molecular Formula | C30H46NO4P |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | 2-[3-[[1-[2-(4,4-dimethylpentyl)-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]propyl-methylphosphinic acid |
| SMILES | COc1ccc(CCCC(C)(C)C)c(N2CCC(COc3cccc(C(C)CP(C)(=O)O)c3)CC2)c1 |
| InChI | InChI=1S/C30H46NO4P/c1-23(22-36(6,32)33)26-9-7-11-28(19-26)35-21-24-14-17-31(18-15-24)29-20-27(34-5)13-12-25(29)10-8-16-30(2,3)4/h7,9,11-13,19-20,23-24H,8,10,14-18,21-22H2,1-6H3,(H,32,33) |
| InChIKey | NQNYODNQUPPKHS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|