C28H40NO5P — CID 177151636
[(2S)-2-hydroxy-2-[3-[[4-(5-methoxy-2-piperidin-1-ylphenyl)cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid (PubChem CID 177151636) has the molecular formula C28H40NO5P and a molecular weight of 501.60 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[3-[[4-(5-methoxy-2-piperidin-1-ylphenyl)cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid.
| Compound Name | [(2S)-2-hydroxy-2-[3-[[4-(5-methoxy-2-piperidin-1-ylphenyl)cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 177151636 |
| Molecular Formula | C28H40NO5P |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | [(2S)-2-hydroxy-2-[3-[[4-(5-methoxy-2-piperidin-1-ylphenyl)cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid |
| SMILES | COc1ccc(N2CCCCC2)c(C2CCC(COc3cccc([C@H](O)CP(C)(=O)O)c3)CC2)c1 |
| InChI | InChI=1S/C28H40NO5P/c1-33-24-13-14-27(29-15-4-3-5-16-29)26(18-24)22-11-9-21(10-12-22)19-34-25-8-6-7-23(17-25)28(30)20-35(2,31)32/h6-8,13-14,17-18,21-22,28,30H,3-5,9-12,15-16,19-20H2,1-2H3,(H,31,32)/t21?,22?,28-/m1/s1 |
| InChIKey | BTLJEROKZFRCNF-CBIUGAAKSA-N |
| XLogP | 5.97 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|