C24H28FNO2 — CID 142337629
(3R)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]butanenitrile (PubChem CID 142337629) has the molecular formula C24H28FNO2 and a molecular weight of 381.49 g/mol. Its IUPAC name is (3R)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]butanenitrile.
| Compound Name | (3R)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]butanenitrile |
|---|---|
| PubChem CID | 142337629 |
| Molecular Formula | C24H28FNO2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (3R)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]butanenitrile |
| SMILES | COc1ccc(F)c(C2CCC(COc3cccc([C@H](C)CC#N)c3)CC2)c1 |
| InChI | InChI=1S/C24H28FNO2/c1-17(12-13-26)20-4-3-5-22(14-20)28-16-18-6-8-19(9-7-18)23-15-21(27-2)10-11-24(23)25/h3-5,10-11,14-15,17-19H,6-9,12,16H2,1-2H3/t17-,18?,19?/m1/s1 |
| InChIKey | SVGCLLNHBGACPV-LMDPOFIKSA-N |
| XLogP | 6.20 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |