C27H36FO4P — CID 167176174
[(2S)-2-cyclopropyl-2-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]ethyl]-ethylphosphinic acid (PubChem CID 167176174) has the molecular formula C27H36FO4P and a molecular weight of 474.55 g/mol. Its IUPAC name is [(2S)-2-cyclopropyl-2-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]ethyl]-ethylphosphinic acid.
| Compound Name | [(2S)-2-cyclopropyl-2-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]ethyl]-ethylphosphinic acid |
|---|---|
| PubChem CID | 167176174 |
| Molecular Formula | C27H36FO4P |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(2S)-2-cyclopropyl-2-[3-[[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]methoxy]phenyl]ethyl]-ethylphosphinic acid |
| SMILES | CCP(=O)(O)C[C@H](c1cccc(OCC2CCC(c3cc(OC)ccc3F)CC2)c1)C1CC1 |
| InChI | InChI=1S/C27H36FO4P/c1-3-33(29,30)18-26(21-11-12-21)22-5-4-6-24(15-22)32-17-19-7-9-20(10-8-19)25-16-23(31-2)13-14-27(25)28/h4-6,13-16,19-21,26H,3,7-12,17-18H2,1-2H3,(H,29,30)/t19?,20?,26-/m0/s1 |
| InChIKey | IFRPQHZQNFASCJ-SALGDXJJSA-N |
| XLogP | 6.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|