C27H37O5P — CID 177151546
[(2S)-2-[3-[[4-(5-cyclobutyl-2-methoxyphenyl)cyclohexyl]methoxy]phenyl]-2-hydroxyethyl]-methylphosphinic acid (PubChem CID 177151546) has the molecular formula C27H37O5P and a molecular weight of 472.56 g/mol. Its IUPAC name is [(2S)-2-[3-[[4-(5-cyclobutyl-2-methoxyphenyl)cyclohexyl]methoxy]phenyl]-2-hydroxyethyl]-methylphosphinic acid.
| Compound Name | [(2S)-2-[3-[[4-(5-cyclobutyl-2-methoxyphenyl)cyclohexyl]methoxy]phenyl]-2-hydroxyethyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 177151546 |
| Molecular Formula | C27H37O5P |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [(2S)-2-[3-[[4-(5-cyclobutyl-2-methoxyphenyl)cyclohexyl]methoxy]phenyl]-2-hydroxyethyl]-methylphosphinic acid |
| SMILES | COc1ccc(C2CCC2)cc1C1CCC(COc2cccc([C@H](O)CP(C)(=O)O)c2)CC1 |
| InChI | InChI=1S/C27H37O5P/c1-31-27-14-13-22(20-5-3-6-20)16-25(27)21-11-9-19(10-12-21)17-32-24-8-4-7-23(15-24)26(28)18-33(2,29)30/h4,7-8,13-16,19-21,26,28H,3,5-6,9-12,17-18H2,1-2H3,(H,29,30)/t19?,21?,26-/m1/s1 |
| InChIKey | PYNMNOSAMBZEMP-YBFPRZSNSA-N |
| XLogP | 6.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|