C26H37FNO4P — CID 167176176
[(2S)-2-cyclopropyl-2-[3-[[4-[(1E,3E)-4-fluoro-1-methoxy-1-(methylideneamino)penta-1,3-dien-3-yl]cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid (PubChem CID 167176176) has the molecular formula C26H37FNO4P and a molecular weight of 477.56 g/mol. Its IUPAC name is [(2S)-2-cyclopropyl-2-[3-[[4-[(1E,3E)-4-fluoro-1-methoxy-1-(methylideneamino)penta-1,3-dien-3-yl]cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid.
| Compound Name | [(2S)-2-cyclopropyl-2-[3-[[4-[(1E,3E)-4-fluoro-1-methoxy-1-(methylideneamino)penta-1,3-dien-3-yl]cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 167176176 |
| Molecular Formula | C26H37FNO4P |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [(2S)-2-cyclopropyl-2-[3-[[4-[(1E,3E)-4-fluoro-1-methoxy-1-(methylideneamino)penta-1,3-dien-3-yl]cyclohexyl]methoxy]phenyl]ethyl]-methylphosphinic acid |
| SMILES | C=N/C(=C\C(=C(/C)F)C1CCC(COc2cccc([C@@H](CP(C)(=O)O)C3CC3)c2)CC1)OC |
| InChI | InChI=1S/C26H37FNO4P/c1-18(27)24(15-26(28-2)31-3)20-10-8-19(9-11-20)16-32-23-7-5-6-22(14-23)25(21-12-13-21)17-33(4,29)30/h5-7,14-15,19-21,25H,2,8-13,16-17H2,1,3-4H3,(H,29,30)/b24-18-,26-15+/t19?,20?,25-/m0/s1 |
| InChIKey | RYNDGGWTYAWVCH-AZBZIGMKSA-N |
| XLogP | 6.70 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|