H5O9PSZn — CID 174227864
hydroxy dihydrogen phosphate;sulfuric acid;zinc (PubChem CID 174227864) has the molecular formula H5O9PSZn and a molecular weight of 277.46 g/mol. Its IUPAC name is hydroxy dihydrogen phosphate;sulfuric acid;zinc.
| Compound Name | hydroxy dihydrogen phosphate;sulfuric acid;zinc |
|---|---|
| PubChem CID | 174227864 |
| Molecular Formula | H5O9PSZn |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 275.87 |
| IUPAC Name | hydroxy dihydrogen phosphate;sulfuric acid;zinc |
| SMILES | O=P(O)(O)OO.O=S(=O)(O)O.[Zn] |
| InChI | InChI=1S/H3O5P.H2O4S.Zn/c1-5-6(2,3)4;1-5(2,3)4;/h1H,(H2,2,3,4);(H2,1,2,3,4); |
| InChIKey | JSAXWYOMZGDWFQ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|