C9H7IN2O2S — CID 174230517
(4-iodo-7-methyl-1,3-benzothiazol-2-yl)carbamic acid (PubChem CID 174230517) has the molecular formula C9H7IN2O2S and a molecular weight of 334.14 g/mol. Its IUPAC name is (4-iodo-7-methyl-1,3-benzothiazol-2-yl)carbamic acid.
| Compound Name | (4-iodo-7-methyl-1,3-benzothiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 174230517 |
| Molecular Formula | C9H7IN2O2S |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | (4-iodo-7-methyl-1,3-benzothiazol-2-yl)carbamic acid |
| SMILES | Cc1ccc(I)c2nc(NC(=O)O)sc12 |
| InChI | InChI=1S/C9H7IN2O2S/c1-4-2-3-5(10)6-7(4)15-8(11-6)12-9(13)14/h2-3H,1H3,(H,11,12)(H,13,14) |
| InChIKey | KICDPWVRZQFJSH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|