C5H15N3S2 — CID 174232024
carbamodithioic acid;N',N'-dimethylethane-1,2-diamine (PubChem CID 174232024) has the molecular formula C5H15N3S2 and a molecular weight of 181.33 g/mol. Its IUPAC name is carbamodithioic acid;N',N'-dimethylethane-1,2-diamine.
| Compound Name | carbamodithioic acid;N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 174232024 |
| Molecular Formula | C5H15N3S2 |
| Molecular Weight | 181.33 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | carbamodithioic acid;N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCN.NC(=S)S |
| InChI | InChI=1S/C4H12N2.CH3NS2/c1-6(2)4-3-5;2-1(3)4/h3-5H2,1-2H3;(H3,2,3,4) |
| InChIKey | LWORPPRPNVWWPZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|