C26H33N7O3 — CID 174232770
(1R,2S,5S)-3-(2-acetamido-3,3-dimethylbutanoyl)-N-[cyano-[5-(1H-pyrazol-5-yl)-3-pyridinyl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 174232770) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is (1R,2S,5S)-3-(2-acetamido-3,3-dimethylbutanoyl)-N-[cyano-[5-(1H-pyrazol-5-yl)-3-pyridinyl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-3-(2-acetamido-3,3-dimethylbutanoyl)-N-[cyano-[5-(1H-pyrazol-5-yl)-3-pyridinyl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 174232770 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (1R,2S,5S)-3-(2-acetamido-3,3-dimethylbutanoyl)-N-[cyano-[5-(1H-pyrazol-5-yl)-3-pyridinyl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(=O)NC(C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C#N)c1cncc(-c3ccn[nH]3)c1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H33N7O3/c1-14(34)30-22(25(2,3)4)24(36)33-13-17-20(26(17,5)6)21(33)23(35)31-19(10-27)16-9-15(11-28-12-16)18-7-8-29-32-18/h7-9,11-12,17,19-22H,13H2,1-6H3,(H,29,32)(H,30,34)(H,31,35)/t17-,19?,20-,21-,22?/m0/s1 |
| InChIKey | HBWOXDGWYXGIDJ-WRHBAFKPSA-N |
| XLogP | 2.19 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |