C22H36N4O2 — CID 174235485
[4-[[4-(3-aminophenyl)piperazin-1-yl]methyl]-2-tert-butylcyclohexyl]carbamic acid (PubChem CID 174235485) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is [4-[[4-(3-aminophenyl)piperazin-1-yl]methyl]-2-tert-butylcyclohexyl]carbamic acid.
| Compound Name | [4-[[4-(3-aminophenyl)piperazin-1-yl]methyl]-2-tert-butylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174235485 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | [4-[[4-(3-aminophenyl)piperazin-1-yl]methyl]-2-tert-butylcyclohexyl]carbamic acid |
| SMILES | CC(C)(C)C1CC(CN2CCN(c3cccc(N)c3)CC2)CCC1NC(=O)O |
| InChI | InChI=1S/C22H36N4O2/c1-22(2,3)19-13-16(7-8-20(19)24-21(27)28)15-25-9-11-26(12-10-25)18-6-4-5-17(23)14-18/h4-6,14,16,19-20,24H,7-13,15,23H2,1-3H3,(H,27,28) |
| InChIKey | RWEBDOYTZQIKLT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|