C20H14ClF4N5 — CID 174236125
(1S)-1-chloro-2-(3-fluoro-2-pyridinyl)-1-[3-[5-(trifluoromethyl)indazol-1-yl]-2-pyridinyl]ethanamine (PubChem CID 174236125) has the molecular formula C20H14ClF4N5 and a molecular weight of 435.81 g/mol. Its IUPAC name is (1S)-1-chloro-2-(3-fluoro-2-pyridinyl)-1-[3-[5-(trifluoromethyl)indazol-1-yl]-2-pyridinyl]ethanamine.
| Compound Name | (1S)-1-chloro-2-(3-fluoro-2-pyridinyl)-1-[3-[5-(trifluoromethyl)indazol-1-yl]-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 174236125 |
| Molecular Formula | C20H14ClF4N5 |
| Molecular Weight | 435.81 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (1S)-1-chloro-2-(3-fluoro-2-pyridinyl)-1-[3-[5-(trifluoromethyl)indazol-1-yl]-2-pyridinyl]ethanamine |
| SMILES | N[C@](Cl)(Cc1ncccc1F)c1ncccc1-n1ncc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H14ClF4N5/c21-19(26,10-15-14(22)3-1-7-27-15)18-17(4-2-8-28-18)30-16-6-5-13(20(23,24)25)9-12(16)11-29-30/h1-9,11H,10,26H2/t19-/m1/s1 |
| InChIKey | IBBAMWDUSJXQDL-LJQANCHMSA-N |
| XLogP | 4.57 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|