C22H16ClF4N2O+ — CID 143372233
[3-(4-chloro-2-fluorophenyl)-1,1,1-trifluoro-2-(1-phenylindazol-5-yl)propan-2-yl]oxidanium (PubChem CID 143372233) has the molecular formula C22H16ClF4N2O+ and a molecular weight of 435.83 g/mol. Its IUPAC name is [3-(4-chloro-2-fluorophenyl)-1,1,1-trifluoro-2-(1-phenylindazol-5-yl)propan-2-yl]oxidanium.
| Compound Name | [3-(4-chloro-2-fluorophenyl)-1,1,1-trifluoro-2-(1-phenylindazol-5-yl)propan-2-yl]oxidanium |
|---|---|
| PubChem CID | 143372233 |
| Molecular Formula | C22H16ClF4N2O+ |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [3-(4-chloro-2-fluorophenyl)-1,1,1-trifluoro-2-(1-phenylindazol-5-yl)propan-2-yl]oxidanium |
| SMILES | [OH2+]C(Cc1ccc(Cl)cc1F)(c1ccc2c(cnn2-c2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H15ClF4N2O/c23-17-8-6-14(19(24)11-17)12-21(30,22(25,26)27)16-7-9-20-15(10-16)13-28-29(20)18-4-2-1-3-5-18/h1-11,13,30H,12H2/p+1 |
| InChIKey | IDDUWXUSBVINAR-UHFFFAOYSA-O |
| XLogP | 5.54 |
| TPSA | 40.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|