C22H19F2N3O — CID 150429566
1-amino-1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-phenylpropan-2-ol (PubChem CID 150429566) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-amino-1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-phenylpropan-2-ol.
| Compound Name | 1-amino-1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 150429566 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-amino-1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-phenylpropan-2-ol |
| SMILES | NC(F)C(O)(Cc1ccccc1)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19F2N3O/c23-18-7-9-19(10-8-18)27-20-11-6-17(12-16(20)14-26-27)22(28,21(24)25)13-15-4-2-1-3-5-15/h1-12,14,21,28H,13,25H2 |
| InChIKey | HJMRCWTXAVAPRG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|