C22H16F5N3O — CID 174540103
1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-1-(2,4,6-trifluoroanilino)propan-2-ol (PubChem CID 174540103) has the molecular formula C22H16F5N3O and a molecular weight of 433.38 g/mol. Its IUPAC name is 1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-1-(2,4,6-trifluoroanilino)propan-2-ol.
| Compound Name | 1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-1-(2,4,6-trifluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 174540103 |
| Molecular Formula | C22H16F5N3O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-1-(2,4,6-trifluoroanilino)propan-2-ol |
| SMILES | CC(O)(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C22H16F5N3O/c1-22(31,21(27)29-20-17(25)9-15(24)10-18(20)26)13-2-7-19-12(8-13)11-28-30(19)16-5-3-14(23)4-6-16/h2-11,21,29,31H,1H3 |
| InChIKey | CECUEYLZGNSCPV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|