C22H18F4N4 — CID 91060802
3-[1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-yl]benzene-1,2-diamine (PubChem CID 91060802) has the molecular formula C22H18F4N4 and a molecular weight of 414.41 g/mol. Its IUPAC name is 3-[1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-yl]benzene-1,2-diamine.
| Compound Name | 3-[1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 91060802 |
| Molecular Formula | C22H18F4N4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-[1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-yl]benzene-1,2-diamine |
| SMILES | CC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)(c1cccc(N)c1N)C(F)(F)F |
| InChI | InChI=1S/C22H18F4N4/c1-21(22(24,25)26,17-3-2-4-18(27)20(17)28)14-5-10-19-13(11-14)12-29-30(19)16-8-6-15(23)7-9-16/h2-12H,27-28H2,1H3 |
| InChIKey | KZWXAZAQLDLANS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|