C23H17F2N3O — CID 174540095
2-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1H-indol-4-yl)ethanol (PubChem CID 174540095) has the molecular formula C23H17F2N3O and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1H-indol-4-yl)ethanol.
| Compound Name | 2-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1H-indol-4-yl)ethanol |
|---|---|
| PubChem CID | 174540095 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1H-indol-4-yl)ethanol |
| SMILES | OC(CF)(c1ccc2c(cnn2-c2ccc(F)cc2)c1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C23H17F2N3O/c24-14-23(29,20-2-1-3-21-19(20)10-11-26-21)16-4-9-22-15(12-16)13-27-28(22)18-7-5-17(25)6-8-18/h1-13,26,29H,14H2 |
| InChIKey | QMQHRNASGRIYNO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |